About 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate
3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate (PubChem CID 175175993) has the molecular formula C19H21NO4
and a molecular weight of 327.38 g/mol. Its IUPAC name is 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate.
Molecular Properties
| Compound Name | 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate |
| PubChem CID | 175175993 |
| Molecular Formula | C19H21NO4 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate |
| SMILES | O=C(C[C@H](O)c1ccccc1)OCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C19H21NO4/c21-17(15-8-3-1-4-9-15)14-18(22)24-13-7-12-20-19(23)16-10-5-2-6-11-16/h1-6,8-11,17,21H,7,12-14H2,(H,20,23)/t17-/m0/s1 |
| InChIKey | OQZKPIUBWCSONC-KRWDZBQOSA-N |
| XLogP | 2.47 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate?
The IUPAC name of 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate (CID 175175993) is 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate.
What is the SMILES notation for 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate?
The canonical SMILES for 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate is O=C(C[C@H](O)c1ccccc1)OCCCNC(=O)c1ccccc1.
What is the InChIKey of 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate?
The InChIKey is OQZKPIUBWCSONC-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H21NO4/c21-17(15-8-3-1-4-9-15)14-18(22)24-13-7-12-20-19(23)16-10-5-2-6-11-16/h1-6,8-11,17,21H,7,12-14H2,(H,20,23)/t17-/m0/s1.
What are the key properties of 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate?
3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate has a molecular weight of 327.38 g/mol, XLogP of 2.47, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzamidopropyl (3S)-3-hydroxy-3-phenylpropanoate is sourced from PubChem (CID 175175993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).