C30H44N2O6S4 — CID 70467036
oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane;bis(2,2,4-trimethyl-1H-quinolin-1-ium) (PubChem CID 70467036) has the molecular formula C30H44N2O6S4 and a molecular weight of 656.96 g/mol. Its IUPAC name is oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane;bis(2,2,4-trimethyl-1H-quinolin-1-ium).
| Compound Name | oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane;bis(2,2,4-trimethyl-1H-quinolin-1-ium) |
|---|---|
| PubChem CID | 70467036 |
| Molecular Formula | C30H44N2O6S4 |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | oxido-(6-oxidosulfonothioyloxyhexoxy)-oxo-sulfanylidene-λ6-sulfane;bis(2,2,4-trimethyl-1H-quinolin-1-ium) |
| SMILES | CC1=CC(C)(C)[NH2+]c2ccccc21.CC1=CC(C)(C)[NH2+]c2ccccc21.O=S([O-])(=S)OCCCCCCOS(=O)([O-])=S |
| InChI | InChI=1S/2C12H15N.C6H14O6S4/c2*1-9-8-12(2,3)13-11-7-5-4-6-10(9)11;7-15(8,13)11-5-3-1-2-4-6-12-16(9,10)14/h2*4-8,13H,1-3H3;1-6H2,(H,7,8,13)(H,9,10,14) |
| InChIKey | LUDIESQSQXXCMT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 131.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|