C11H20Cl2O2S — CID 79447752
3-[1-chloro-2-(chloromethyl)hexan-2-yl]thiolane 1,1-dioxide (PubChem CID 79447752) has the molecular formula C11H20Cl2O2S and a molecular weight of 287.25 g/mol. Its IUPAC name is 3-[1-chloro-2-(chloromethyl)hexan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-chloro-2-(chloromethyl)hexan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79447752 |
| Molecular Formula | C11H20Cl2O2S |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 3-[1-chloro-2-(chloromethyl)hexan-2-yl]thiolane 1,1-dioxide |
| SMILES | CCCCC(CCl)(CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20Cl2O2S/c1-2-3-5-11(8-12,9-13)10-4-6-16(14,15)7-10/h10H,2-9H2,1H3 |
| InChIKey | ZGELOXCLHMCKEZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|