C13H24Br2O2S — CID 83168418
3-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]thiolane 1,1-dioxide (PubChem CID 83168418) has the molecular formula C13H24Br2O2S and a molecular weight of 404.21 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 83168418 |
| Molecular Formula | C13H24Br2O2S |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]thiolane 1,1-dioxide |
| SMILES | CC(C)CCCC(CBr)(CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24Br2O2S/c1-11(2)4-3-6-13(9-14,10-15)12-5-7-18(16,17)8-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | GQKWEKDGQKTBJY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|