C14H17Br2IO2S — CID 79452676
3-[1-bromo-2-(bromomethyl)-3-(4-iodophenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79452676) has the molecular formula C14H17Br2IO2S and a molecular weight of 536.07 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-3-(4-iodophenyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-3-(4-iodophenyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79452676 |
| Molecular Formula | C14H17Br2IO2S |
| Molecular Weight | 536.07 g/mol |
| Exact Mass | 533.84 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-3-(4-iodophenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)(CBr)Cc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C14H17Br2IO2S/c15-9-14(10-16,12-5-6-20(18,19)8-12)7-11-1-3-13(17)4-2-11/h1-4,12H,5-10H2 |
| InChIKey | RJGDRIRDLWLNMX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.07 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|