C14H20Br2O2S2 — CID 79453695
3-[1-bromo-2-(bromomethyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79453695) has the molecular formula C14H20Br2O2S2 and a molecular weight of 444.25 g/mol. Its IUPAC name is 3-[1-bromo-2-(bromomethyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-2-(bromomethyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79453695 |
| Molecular Formula | C14H20Br2O2S2 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 441.93 |
| IUPAC Name | 3-[1-bromo-2-(bromomethyl)-3-(5-ethylthiophen-2-yl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | CCc1ccc(CC(CBr)(CBr)C2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C14H20Br2O2S2/c1-2-12-3-4-13(19-12)7-14(9-15,10-16)11-5-6-20(17,18)8-11/h3-4,11H,2,5-10H2,1H3 |
| InChIKey | WXEGNXWIIYWFFY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|