C11H22Cl2O2SSi — CID 106324295
[3-chloro-2-(chloromethyl)-2-(1,1-dioxothiolan-3-yl)propyl]-trimethylsilane (PubChem CID 106324295) has the molecular formula C11H22Cl2O2SSi and a molecular weight of 317.35 g/mol. Its IUPAC name is [3-chloro-2-(chloromethyl)-2-(1,1-dioxothiolan-3-yl)propyl]-trimethylsilane.
| Compound Name | [3-chloro-2-(chloromethyl)-2-(1,1-dioxothiolan-3-yl)propyl]-trimethylsilane |
|---|---|
| PubChem CID | 106324295 |
| Molecular Formula | C11H22Cl2O2SSi |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | [3-chloro-2-(chloromethyl)-2-(1,1-dioxothiolan-3-yl)propyl]-trimethylsilane |
| SMILES | C[Si](C)(C)CC(CCl)(CCl)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H22Cl2O2SSi/c1-17(2,3)9-11(7-12,8-13)10-4-5-16(14,15)6-10/h10H,4-9H2,1-3H3 |
| InChIKey | ZANKKYQPHXCDIF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|