C13H24O6SSi — CID 106324344
2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(trimethylsilylmethyl)propanoic acid (PubChem CID 106324344) has the molecular formula C13H24O6SSi and a molecular weight of 336.48 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(trimethylsilylmethyl)propanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(trimethylsilylmethyl)propanoic acid |
|---|---|
| PubChem CID | 106324344 |
| Molecular Formula | C13H24O6SSi |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-3-ethoxy-3-oxo-2-(trimethylsilylmethyl)propanoic acid |
| SMILES | CCOC(=O)C(C[Si](C)(C)C)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H24O6SSi/c1-5-19-12(16)13(11(14)15,9-21(2,3)4)10-6-7-20(17,18)8-10/h10H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | ZFGANGJEAKUXLT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|