C14H24O6S — CID 107889822
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylhexanoic acid (PubChem CID 107889822) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylhexanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylhexanoic acid |
|---|---|
| PubChem CID | 107889822 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-3-methylhexanoic acid |
| SMILES | CCCC(C)C(C(=O)O)(C(=O)OCC)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H24O6S/c1-4-6-10(3)14(12(15)16,13(17)20-5-2)11-7-8-21(18,19)9-11/h10-11H,4-9H2,1-3H3,(H,15,16) |
| InChIKey | GYHJXTJUXGCJDQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|