C11H16F2O6S — CID 103973446
2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4-difluorobutanoic acid (PubChem CID 103973446) has the molecular formula C11H16F2O6S and a molecular weight of 314.31 g/mol. Its IUPAC name is 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4-difluorobutanoic acid.
| Compound Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4-difluorobutanoic acid |
|---|---|
| PubChem CID | 103973446 |
| Molecular Formula | C11H16F2O6S |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-(1,1-dioxothiolan-3-yl)-2-ethoxycarbonyl-4,4-difluorobutanoic acid |
| SMILES | CCOC(=O)C(CC(F)F)(C(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H16F2O6S/c1-2-19-10(16)11(9(14)15,5-8(12)13)7-3-4-20(17,18)6-7/h7-8H,2-6H2,1H3,(H,14,15) |
| InChIKey | SRPZPQQJFGHGRG-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|