C14H24O6S — CID 103972504
diethyl 2-(1,1-dioxothiolan-3-yl)-2-propan-2-ylpropanedioate (PubChem CID 103972504) has the molecular formula C14H24O6S and a molecular weight of 320.41 g/mol. Its IUPAC name is diethyl 2-(1,1-dioxothiolan-3-yl)-2-propan-2-ylpropanedioate.
| Compound Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-propan-2-ylpropanedioate |
|---|---|
| PubChem CID | 103972504 |
| Molecular Formula | C14H24O6S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | diethyl 2-(1,1-dioxothiolan-3-yl)-2-propan-2-ylpropanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)(C(C)C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H24O6S/c1-5-19-12(15)14(10(3)4,13(16)20-6-2)11-7-8-21(17,18)9-11/h10-11H,5-9H2,1-4H3 |
| InChIKey | JZHXWAYYFQVRBF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|