C9H18N2O4S — CID 99976652
ethyl N-(dimethylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate (PubChem CID 99976652) has the molecular formula C9H18N2O4S and a molecular weight of 250.32 g/mol. Its IUPAC name is ethyl N-(dimethylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate.
| Compound Name | ethyl N-(dimethylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
|---|---|
| PubChem CID | 99976652 |
| Molecular Formula | C9H18N2O4S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | ethyl N-(dimethylamino)-N-[(3S)-1,1-dioxothiolan-3-yl]carbamate |
| SMILES | CCOC(=O)N([C@H]1CCS(=O)(=O)C1)N(C)C |
| InChI | InChI=1S/C9H18N2O4S/c1-4-15-9(12)11(10(2)3)8-5-6-16(13,14)7-8/h8H,4-7H2,1-3H3/t8-/m0/s1 |
| InChIKey | PRFLIGSRXHZESE-QMMMGPOBSA-N |
| XLogP | 0.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|