C13H24N2O3S — CID 119033131
N-(1,1-dioxothiolan-3-yl)-3-ethyl-N',N'-dimethylpent-2-enehydrazide (PubChem CID 119033131) has the molecular formula C13H24N2O3S and a molecular weight of 288.41 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-ethyl-N',N'-dimethylpent-2-enehydrazide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-ethyl-N',N'-dimethylpent-2-enehydrazide |
|---|---|
| PubChem CID | 119033131 |
| Molecular Formula | C13H24N2O3S |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-ethyl-N',N'-dimethylpent-2-enehydrazide |
| SMILES | CCC(=CC(=O)N(C1CCS(=O)(=O)C1)N(C)C)CC |
| InChI | InChI=1S/C13H24N2O3S/c1-5-11(6-2)9-13(16)15(14(3)4)12-7-8-19(17,18)10-12/h9,12H,5-8,10H2,1-4H3 |
| InChIKey | FCAQLSDRAUYJPI-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|