C8H16N2O3S — CID 82040848
2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide (PubChem CID 82040848) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
|---|---|
| PubChem CID | 82040848 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)-ethylamino]acetamide |
| SMILES | CCN(CC(N)=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C8H16N2O3S/c1-2-10(5-8(9)11)7-3-4-14(12,13)6-7/h7H,2-6H2,1H3,(H2,9,11) |
| InChIKey | XXJUWROMEDYRFR-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |