C13H25NO2S — CID 62724450
N-[2-(1,1-dioxothiolan-3-yl)-2-ethylbutyl]cyclopropanamine (PubChem CID 62724450) has the molecular formula C13H25NO2S and a molecular weight of 259.41 g/mol. Its IUPAC name is N-[2-(1,1-dioxothiolan-3-yl)-2-ethylbutyl]cyclopropanamine.
| Compound Name | N-[2-(1,1-dioxothiolan-3-yl)-2-ethylbutyl]cyclopropanamine |
|---|---|
| PubChem CID | 62724450 |
| Molecular Formula | C13H25NO2S |
| Molecular Weight | 259.41 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | N-[2-(1,1-dioxothiolan-3-yl)-2-ethylbutyl]cyclopropanamine |
| SMILES | CCC(CC)(CNC1CC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H25NO2S/c1-3-13(4-2,10-14-12-5-6-12)11-7-8-17(15,16)9-11/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | HJAUZDUNDDCAGW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |