C10H21NO2S — CID 103698424
N-(2,2-dimethylbutyl)-1,1-dioxothiolan-3-amine (PubChem CID 103698424) has the molecular formula C10H21NO2S and a molecular weight of 219.35 g/mol. Its IUPAC name is N-(2,2-dimethylbutyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2,2-dimethylbutyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 103698424 |
| Molecular Formula | C10H21NO2S |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | N-(2,2-dimethylbutyl)-1,1-dioxothiolan-3-amine |
| SMILES | CCC(C)(C)CNC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H21NO2S/c1-4-10(2,3)8-11-9-5-6-14(12,13)7-9/h9,11H,4-8H2,1-3H3 |
| InChIKey | LWGZBDYOCRHWEW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |