C7H13F2NO3S — CID 104862624
3-[(1,1-dioxothiolan-3-yl)amino]-2,2-difluoropropan-1-ol (PubChem CID 104862624) has the molecular formula C7H13F2NO3S and a molecular weight of 229.25 g/mol. Its IUPAC name is 3-[(1,1-dioxothiolan-3-yl)amino]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(1,1-dioxothiolan-3-yl)amino]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 104862624 |
| Molecular Formula | C7H13F2NO3S |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3-[(1,1-dioxothiolan-3-yl)amino]-2,2-difluoropropan-1-ol |
| SMILES | O=S1(=O)CCC(NCC(F)(F)CO)C1 |
| InChI | InChI=1S/C7H13F2NO3S/c8-7(9,5-11)4-10-6-1-2-14(12,13)3-6/h6,10-11H,1-5H2 |
| InChIKey | KRTVEAFHBJFINQ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |