C9H19NO4S — CID 66168318
3-[(1,1-dioxothian-4-yl)amino]-2-methylpropane-1,2-diol (PubChem CID 66168318) has the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)amino]-2-methylpropane-1,2-diol.
| Compound Name | 3-[(1,1-dioxothian-4-yl)amino]-2-methylpropane-1,2-diol |
|---|---|
| PubChem CID | 66168318 |
| Molecular Formula | C9H19NO4S |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)amino]-2-methylpropane-1,2-diol |
| SMILES | CC(O)(CO)CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H19NO4S/c1-9(12,7-11)6-10-8-2-4-15(13,14)5-3-8/h8,10-12H,2-7H2,1H3 |
| InChIKey | RPLZLZJUCCJAMI-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |