C11H23NO4S — CID 106249315
1-[(1,1-dioxothian-4-yl)amino]-4-methoxy-2-methylbutan-2-ol (PubChem CID 106249315) has the molecular formula C11H23NO4S and a molecular weight of 265.37 g/mol. Its IUPAC name is 1-[(1,1-dioxothian-4-yl)amino]-4-methoxy-2-methylbutan-2-ol.
| Compound Name | 1-[(1,1-dioxothian-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
|---|---|
| PubChem CID | 106249315 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.37 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 1-[(1,1-dioxothian-4-yl)amino]-4-methoxy-2-methylbutan-2-ol |
| SMILES | COCCC(C)(O)CNC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H23NO4S/c1-11(13,5-6-16-2)9-12-10-3-7-17(14,15)8-4-10/h10,12-13H,3-9H2,1-2H3 |
| InChIKey | LGEUEVKGPYAFPO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |