C11H23NO3S — CID 106184974
3-[(1,1-dioxothian-4-yl)amino]-2,3-dimethylbutan-2-ol (PubChem CID 106184974) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)amino]-2,3-dimethylbutan-2-ol.
| Compound Name | 3-[(1,1-dioxothian-4-yl)amino]-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 106184974 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)amino]-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H23NO3S/c1-10(2,11(3,4)13)12-9-5-7-16(14,15)8-6-9/h9,12-13H,5-8H2,1-4H3 |
| InChIKey | LNDIPOYBKVZAAP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |