C13H27NO3S — CID 103993526
2,3-dimethyl-3-[(3-methylsulfonylcyclohexyl)amino]butan-2-ol (PubChem CID 103993526) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 2,3-dimethyl-3-[(3-methylsulfonylcyclohexyl)amino]butan-2-ol.
| Compound Name | 2,3-dimethyl-3-[(3-methylsulfonylcyclohexyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 103993526 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2,3-dimethyl-3-[(3-methylsulfonylcyclohexyl)amino]butan-2-ol |
| SMILES | CC(C)(O)C(C)(C)NC1CCCC(S(C)(=O)=O)C1 |
| InChI | InChI=1S/C13H27NO3S/c1-12(2,13(3,4)15)14-10-7-6-8-11(9-10)18(5,16)17/h10-11,14-15H,6-9H2,1-5H3 |
| InChIKey | MOFZWEKASUBLLI-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |