C10H19NO4S — CID 43726170
methyl 2-[(1,1-dioxothian-4-yl)amino]-2-methylpropanoate (PubChem CID 43726170) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is methyl 2-[(1,1-dioxothian-4-yl)amino]-2-methylpropanoate.
| Compound Name | methyl 2-[(1,1-dioxothian-4-yl)amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 43726170 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | methyl 2-[(1,1-dioxothian-4-yl)amino]-2-methylpropanoate |
| SMILES | COC(=O)C(C)(C)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H19NO4S/c1-10(2,9(12)15-3)11-8-4-6-16(13,14)7-5-8/h8,11H,4-7H2,1-3H3 |
| InChIKey | CSMQMQYEJLEWHS-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |