C10H17NO2S — CID 63997125
N-(2-methylbut-3-yn-2-yl)-1,1-dioxothian-4-amine (PubChem CID 63997125) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is N-(2-methylbut-3-yn-2-yl)-1,1-dioxothian-4-amine.
| Compound Name | N-(2-methylbut-3-yn-2-yl)-1,1-dioxothian-4-amine |
|---|---|
| PubChem CID | 63997125 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | N-(2-methylbut-3-yn-2-yl)-1,1-dioxothian-4-amine |
| SMILES | C#CC(C)(C)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H17NO2S/c1-4-10(2,3)11-9-5-7-14(12,13)8-6-9/h1,9,11H,5-8H2,2-3H3 |
| InChIKey | PWZYIDPKIBRLCI-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|