C12H24N2O3S — CID 65264497
3-amino-N-(1,1-dioxothian-4-yl)-2,2,3-trimethylbutanamide (PubChem CID 65264497) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothian-4-yl)-2,2,3-trimethylbutanamide.
| Compound Name | 3-amino-N-(1,1-dioxothian-4-yl)-2,2,3-trimethylbutanamide |
|---|---|
| PubChem CID | 65264497 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 3-amino-N-(1,1-dioxothian-4-yl)-2,2,3-trimethylbutanamide |
| SMILES | CC(C)(N)C(C)(C)C(=O)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H24N2O3S/c1-11(2,12(3,4)13)10(15)14-9-5-7-18(16,17)8-6-9/h9H,5-8,13H2,1-4H3,(H,14,15) |
| InChIKey | DYCJMZBANXCPJT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |