C7H16N4O2S — CID 104882020
1-amino-3-(1,1-dioxothian-4-yl)-2-methylguanidine (PubChem CID 104882020) has the molecular formula C7H16N4O2S and a molecular weight of 220.30 g/mol. Its IUPAC name is 1-amino-3-(1,1-dioxothian-4-yl)-2-methylguanidine.
| Compound Name | 1-amino-3-(1,1-dioxothian-4-yl)-2-methylguanidine |
|---|---|
| PubChem CID | 104882020 |
| Molecular Formula | C7H16N4O2S |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 1-amino-3-(1,1-dioxothian-4-yl)-2-methylguanidine |
| SMILES | C/N=C(\NN)NC1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C7H16N4O2S/c1-9-7(11-8)10-6-2-4-14(12,13)5-3-6/h6H,2-5,8H2,1H3,(H2,9,10,11) |
| InChIKey | BAPYGYZLUUCTEO-UHFFFAOYSA-N |
| XLogP | -1.40 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|