C11H19NO4S — CID 103239258
methyl 2-cyclopropyl-2-[(1,1-dioxothian-4-yl)amino]acetate (PubChem CID 103239258) has the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. Its IUPAC name is methyl 2-cyclopropyl-2-[(1,1-dioxothian-4-yl)amino]acetate.
| Compound Name | methyl 2-cyclopropyl-2-[(1,1-dioxothian-4-yl)amino]acetate |
|---|---|
| PubChem CID | 103239258 |
| Molecular Formula | C11H19NO4S |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | methyl 2-cyclopropyl-2-[(1,1-dioxothian-4-yl)amino]acetate |
| SMILES | COC(=O)C(NC1CCS(=O)(=O)CC1)C1CC1 |
| InChI | InChI=1S/C11H19NO4S/c1-16-11(13)10(8-2-3-8)12-9-4-6-17(14,15)7-5-9/h8-10,12H,2-7H2,1H3 |
| InChIKey | QVQNRRHWCNUVHW-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |