methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate

C11H19NO2 — CID 103244098

IUPACmethyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate
SMILESCOC(=O)C(NC1CC1(C)C)C1CC1
InChIInChI=1S/C11H19NO2/c1-11(2)6-8(11)12-9(7-4-5-7)10(13)14-3/h7-9,12H,4-6H2,1-3H3
InChIKeyRCKVZSRZEMTPIC-UHFFFAOYSA-N
MW197.28 g/mol
LogP1.33
Rot. Bonds4

About methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate

methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate (PubChem CID 103244098) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate
PubChem CID103244098
Molecular FormulaC11H19NO2
Molecular Weight197.28 g/mol
Exact Mass197.14
IUPAC Namemethyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate
SMILESCOC(=O)C(NC1CC1(C)C)C1CC1
InChIInChI=1S/C11H19NO2/c1-11(2)6-8(11)12-9(7-4-5-7)10(13)14-3/h7-9,12H,4-6H2,1-3H3
InChIKeyRCKVZSRZEMTPIC-UHFFFAOYSA-N
XLogP1.33
TPSA38.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500197.28
LogP ≤ 51.33
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate?
The IUPAC name of methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate (CID 103244098) is methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate.
What is the SMILES notation for methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate?
The canonical SMILES for methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate is COC(=O)C(NC1CC1(C)C)C1CC1.
What is the InChIKey of methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate?
The InChIKey is RCKVZSRZEMTPIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO2/c1-11(2)6-8(11)12-9(7-4-5-7)10(13)14-3/h7-9,12H,4-6H2,1-3H3.
What are the key properties of methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate?
methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate has a molecular weight of 197.28 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopropyl-2-[(2,2-dimethylcyclopropyl)amino]acetate is sourced from PubChem (CID 103244098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).