C12H15F2NO2S — CID 116788690
N-(2,2-difluoro-2-phenylethyl)-1,1-dioxothiolan-3-amine (PubChem CID 116788690) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is N-(2,2-difluoro-2-phenylethyl)-1,1-dioxothiolan-3-amine.
| Compound Name | N-(2,2-difluoro-2-phenylethyl)-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 116788690 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(2,2-difluoro-2-phenylethyl)-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NCC(F)(F)c2ccccc2)C1 |
| InChI | InChI=1S/C12H15F2NO2S/c13-12(14,10-4-2-1-3-5-10)9-15-11-6-7-18(16,17)8-11/h1-5,11,15H,6-9H2 |
| InChIKey | XNVJGVUPOYTMBD-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |