C14H17F3N2O3S — CID 75427492
1-(1,1-dioxothiolan-3-yl)-3-(1,1,1-trifluoro-3-phenylpropan-2-yl)urea (PubChem CID 75427492) has the molecular formula C14H17F3N2O3S and a molecular weight of 350.36 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-(1,1,1-trifluoro-3-phenylpropan-2-yl)urea.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-(1,1,1-trifluoro-3-phenylpropan-2-yl)urea |
|---|---|
| PubChem CID | 75427492 |
| Molecular Formula | C14H17F3N2O3S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-(1,1,1-trifluoro-3-phenylpropan-2-yl)urea |
| SMILES | O=C(NC1CCS(=O)(=O)C1)NC(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O3S/c15-14(16,17)12(8-10-4-2-1-3-5-10)19-13(20)18-11-6-7-23(21,22)9-11/h1-5,11-12H,6-9H2,(H2,18,19,20) |
| InChIKey | PDLIPGBGXBGBOZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |