C14H16Cl3FO2S — CID 115984641
3-[1,3-dichloro-2-[(2-chloro-3-fluorophenyl)methyl]propan-2-yl]thiolane 1,1-dioxide (PubChem CID 115984641) has the molecular formula C14H16Cl3FO2S and a molecular weight of 373.70 g/mol. Its IUPAC name is 3-[1,3-dichloro-2-[(2-chloro-3-fluorophenyl)methyl]propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1,3-dichloro-2-[(2-chloro-3-fluorophenyl)methyl]propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 115984641 |
| Molecular Formula | C14H16Cl3FO2S |
| Molecular Weight | 373.70 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | 3-[1,3-dichloro-2-[(2-chloro-3-fluorophenyl)methyl]propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CCl)(CCl)Cc2cccc(F)c2Cl)C1 |
| InChI | InChI=1S/C14H16Cl3FO2S/c15-8-14(9-16,11-4-5-21(19,20)7-11)6-10-2-1-3-12(18)13(10)17/h1-3,11H,4-9H2 |
| InChIKey | ORUATIPCPRDJOT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.70 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|