C12H16O4S — CID 115047818
3-[1-(1,1-dioxothiolan-3-yl)-1-hydroxyethyl]phenol (PubChem CID 115047818) has the molecular formula C12H16O4S and a molecular weight of 256.32 g/mol. Its IUPAC name is 3-[1-(1,1-dioxothiolan-3-yl)-1-hydroxyethyl]phenol.
| Compound Name | 3-[1-(1,1-dioxothiolan-3-yl)-1-hydroxyethyl]phenol |
|---|---|
| PubChem CID | 115047818 |
| Molecular Formula | C12H16O4S |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 3-[1-(1,1-dioxothiolan-3-yl)-1-hydroxyethyl]phenol |
| SMILES | CC(O)(c1cccc(O)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H16O4S/c1-12(14,9-3-2-4-11(13)7-9)10-5-6-17(15,16)8-10/h2-4,7,10,13-14H,5-6,8H2,1H3 |
| InChIKey | VFTDZLBNUXFUEE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |