C13H15Br2ClO2S — CID 79455512
3-[1,3-dibromo-2-(3-chlorophenyl)propan-2-yl]thiolane 1,1-dioxide (PubChem CID 79455512) has the molecular formula C13H15Br2ClO2S and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-[1,3-dibromo-2-(3-chlorophenyl)propan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1,3-dibromo-2-(3-chlorophenyl)propan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 79455512 |
| Molecular Formula | C13H15Br2ClO2S |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 427.88 |
| IUPAC Name | 3-[1,3-dibromo-2-(3-chlorophenyl)propan-2-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(CBr)(CBr)c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C13H15Br2ClO2S/c14-8-13(9-15,10-2-1-3-12(16)6-10)11-4-5-19(17,18)7-11/h1-3,6,11H,4-5,7-9H2 |
| InChIKey | BHYNHVXJGHOBMX-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|