C9H8Br3Cl — CID 10960134
1-chloro-3-(1,2,3-tribromopropan-2-yl)benzene (PubChem CID 10960134) has the molecular formula C9H8Br3Cl and a molecular weight of 391.33 g/mol. Its IUPAC name is 1-chloro-3-(1,2,3-tribromopropan-2-yl)benzene.
| Compound Name | 1-chloro-3-(1,2,3-tribromopropan-2-yl)benzene |
|---|---|
| PubChem CID | 10960134 |
| Molecular Formula | C9H8Br3Cl |
| Molecular Weight | 391.33 g/mol |
| Exact Mass | 387.79 |
| IUPAC Name | 1-chloro-3-(1,2,3-tribromopropan-2-yl)benzene |
| SMILES | Clc1cccc(C(Br)(CBr)CBr)c1 |
| InChI | InChI=1S/C9H8Br3Cl/c10-5-9(12,6-11)7-2-1-3-8(13)4-7/h1-4H,5-6H2 |
| InChIKey | PGYMKIYIJLOUIG-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.33 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|