C15H21Br2Cl — CID 83169386
1-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]-3-chlorobenzene (PubChem CID 83169386) has the molecular formula C15H21Br2Cl and a molecular weight of 396.59 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]-3-chlorobenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]-3-chlorobenzene |
|---|---|
| PubChem CID | 83169386 |
| Molecular Formula | C15H21Br2Cl |
| Molecular Weight | 396.59 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-6-methylheptan-2-yl]-3-chlorobenzene |
| SMILES | CC(C)CCCC(CBr)(CBr)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21Br2Cl/c1-12(2)5-4-8-15(10-16,11-17)13-6-3-7-14(18)9-13/h3,6-7,9,12H,4-5,8,10-11H2,1-2H3 |
| InChIKey | VQOGLRCQPOGVIU-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|