C14H16Br2ClF3O — CID 79446848
1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-3-chlorobenzene (PubChem CID 79446848) has the molecular formula C14H16Br2ClF3O and a molecular weight of 452.54 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-3-chlorobenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-3-chlorobenzene |
|---|---|
| PubChem CID | 79446848 |
| Molecular Formula | C14H16Br2ClF3O |
| Molecular Weight | 452.54 g/mol |
| Exact Mass | 449.92 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-3-chlorobenzene |
| SMILES | FC(F)(F)COCCCC(CBr)(CBr)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H16Br2ClF3O/c15-8-13(9-16,11-3-1-4-12(17)7-11)5-2-6-21-10-14(18,19)20/h1,3-4,7H,2,5-6,8-10H2 |
| InChIKey | QFUIPRKMZGDNCA-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.54 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|