C13H17Br3O — CID 79455690
1-bromo-3-[1-bromo-2-(bromomethyl)-5-methoxypentan-2-yl]benzene (PubChem CID 79455690) has the molecular formula C13H17Br3O and a molecular weight of 428.99 g/mol. Its IUPAC name is 1-bromo-3-[1-bromo-2-(bromomethyl)-5-methoxypentan-2-yl]benzene.
| Compound Name | 1-bromo-3-[1-bromo-2-(bromomethyl)-5-methoxypentan-2-yl]benzene |
|---|---|
| PubChem CID | 79455690 |
| Molecular Formula | C13H17Br3O |
| Molecular Weight | 428.99 g/mol |
| Exact Mass | 425.88 |
| IUPAC Name | 1-bromo-3-[1-bromo-2-(bromomethyl)-5-methoxypentan-2-yl]benzene |
| SMILES | COCCCC(CBr)(CBr)c1cccc(Br)c1 |
| InChI | InChI=1S/C13H17Br3O/c1-17-7-3-6-13(9-14,10-15)11-4-2-5-12(16)8-11/h2,4-5,8H,3,6-7,9-10H2,1H3 |
| InChIKey | IWWWSLAYXDWMHN-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.99 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|