C16H24Br2O2 — CID 103185131
1-[1-bromo-2-(bromomethyl)-4-(3-methoxypropoxy)butan-2-yl]-3-methylbenzene (PubChem CID 103185131) has the molecular formula C16H24Br2O2 and a molecular weight of 408.17 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-4-(3-methoxypropoxy)butan-2-yl]-3-methylbenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-4-(3-methoxypropoxy)butan-2-yl]-3-methylbenzene |
|---|---|
| PubChem CID | 103185131 |
| Molecular Formula | C16H24Br2O2 |
| Molecular Weight | 408.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-4-(3-methoxypropoxy)butan-2-yl]-3-methylbenzene |
| SMILES | COCCCOCCC(CBr)(CBr)c1cccc(C)c1 |
| InChI | InChI=1S/C16H24Br2O2/c1-14-5-3-6-15(11-14)16(12-17,13-18)7-10-20-9-4-8-19-2/h3,5-6,11H,4,7-10,12-13H2,1-2H3 |
| InChIKey | FAPSSSGUVDXWHY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|