C14H20Cl2O — CID 79453993
1-[1-chloro-2-(chloromethyl)-4-ethoxybutan-2-yl]-3-methylbenzene (PubChem CID 79453993) has the molecular formula C14H20Cl2O and a molecular weight of 275.22 g/mol. Its IUPAC name is 1-[1-chloro-2-(chloromethyl)-4-ethoxybutan-2-yl]-3-methylbenzene.
| Compound Name | 1-[1-chloro-2-(chloromethyl)-4-ethoxybutan-2-yl]-3-methylbenzene |
|---|---|
| PubChem CID | 79453993 |
| Molecular Formula | C14H20Cl2O |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | 1-[1-chloro-2-(chloromethyl)-4-ethoxybutan-2-yl]-3-methylbenzene |
| SMILES | CCOCCC(CCl)(CCl)c1cccc(C)c1 |
| InChI | InChI=1S/C14H20Cl2O/c1-3-17-8-7-14(10-15,11-16)13-6-4-5-12(2)9-13/h4-6,9H,3,7-8,10-11H2,1-2H3 |
| InChIKey | SQDNKOPFLAFROA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|