C15H21Cl3O — CID 79453753
1-[4-butoxy-1-chloro-2-(chloromethyl)butan-2-yl]-3-chlorobenzene (PubChem CID 79453753) has the molecular formula C15H21Cl3O and a molecular weight of 323.69 g/mol. Its IUPAC name is 1-[4-butoxy-1-chloro-2-(chloromethyl)butan-2-yl]-3-chlorobenzene.
| Compound Name | 1-[4-butoxy-1-chloro-2-(chloromethyl)butan-2-yl]-3-chlorobenzene |
|---|---|
| PubChem CID | 79453753 |
| Molecular Formula | C15H21Cl3O |
| Molecular Weight | 323.69 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | 1-[4-butoxy-1-chloro-2-(chloromethyl)butan-2-yl]-3-chlorobenzene |
| SMILES | CCCCOCCC(CCl)(CCl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21Cl3O/c1-2-3-8-19-9-7-15(11-16,12-17)13-5-4-6-14(18)10-13/h4-6,10H,2-3,7-9,11-12H2,1H3 |
| InChIKey | TZMAXAWCUHTEFX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.69 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|