C14H12Br4S — CID 79455363
4-bromo-2-[3-bromo-2-(bromomethyl)-2-(3-bromophenyl)propyl]thiophene (PubChem CID 79455363) has the molecular formula C14H12Br4S and a molecular weight of 531.93 g/mol. Its IUPAC name is 4-bromo-2-[3-bromo-2-(bromomethyl)-2-(3-bromophenyl)propyl]thiophene.
| Compound Name | 4-bromo-2-[3-bromo-2-(bromomethyl)-2-(3-bromophenyl)propyl]thiophene |
|---|---|
| PubChem CID | 79455363 |
| Molecular Formula | C14H12Br4S |
| Molecular Weight | 531.93 g/mol |
| Exact Mass | 527.74 |
| IUPAC Name | 4-bromo-2-[3-bromo-2-(bromomethyl)-2-(3-bromophenyl)propyl]thiophene |
| SMILES | BrCC(CBr)(Cc1cc(Br)cs1)c1cccc(Br)c1 |
| InChI | InChI=1S/C14H12Br4S/c15-8-14(9-16,6-13-5-12(18)7-19-13)10-2-1-3-11(17)4-10/h1-5,7H,6,8-9H2 |
| InChIKey | MUDZBOYFPMHMEP-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.93 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|