C14H12BrCl2FS — CID 79453821
4-bromo-2-[3-chloro-2-(chloromethyl)-2-(4-fluorophenyl)propyl]thiophene (PubChem CID 79453821) has the molecular formula C14H12BrCl2FS and a molecular weight of 382.13 g/mol. Its IUPAC name is 4-bromo-2-[3-chloro-2-(chloromethyl)-2-(4-fluorophenyl)propyl]thiophene.
| Compound Name | 4-bromo-2-[3-chloro-2-(chloromethyl)-2-(4-fluorophenyl)propyl]thiophene |
|---|---|
| PubChem CID | 79453821 |
| Molecular Formula | C14H12BrCl2FS |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 379.92 |
| IUPAC Name | 4-bromo-2-[3-chloro-2-(chloromethyl)-2-(4-fluorophenyl)propyl]thiophene |
| SMILES | Fc1ccc(C(CCl)(CCl)Cc2cc(Br)cs2)cc1 |
| InChI | InChI=1S/C14H12BrCl2FS/c15-11-5-13(19-7-11)6-14(8-16,9-17)10-1-3-12(18)4-2-10/h1-5,7H,6,8-9H2 |
| InChIKey | POWNZVLDYHIRPN-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|