C12H12Br3F3O — CID 106706660
1-bromo-2-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]benzene (PubChem CID 106706660) has the molecular formula C12H12Br3F3O and a molecular weight of 468.93 g/mol. Its IUPAC name is 1-bromo-2-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]benzene.
| Compound Name | 1-bromo-2-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]benzene |
|---|---|
| PubChem CID | 106706660 |
| Molecular Formula | C12H12Br3F3O |
| Molecular Weight | 468.93 g/mol |
| Exact Mass | 465.84 |
| IUPAC Name | 1-bromo-2-[1-bromo-2-(bromomethyl)-3-(2,2,2-trifluoroethoxy)propan-2-yl]benzene |
| SMILES | FC(F)(F)COCC(CBr)(CBr)c1ccccc1Br |
| InChI | InChI=1S/C12H12Br3F3O/c13-5-11(6-14,7-19-8-12(16,17)18)9-3-1-2-4-10(9)15/h1-4H,5-8H2 |
| InChIKey | GVSAQJSEOPFBTJ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.93 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|