C15H19Br2F3O — CID 79446247
1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-2-methylbenzene (PubChem CID 79446247) has the molecular formula C15H19Br2F3O and a molecular weight of 432.12 g/mol. Its IUPAC name is 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-2-methylbenzene.
| Compound Name | 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-2-methylbenzene |
|---|---|
| PubChem CID | 79446247 |
| Molecular Formula | C15H19Br2F3O |
| Molecular Weight | 432.12 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | 1-[1-bromo-2-(bromomethyl)-5-(2,2,2-trifluoroethoxy)pentan-2-yl]-2-methylbenzene |
| SMILES | Cc1ccccc1C(CBr)(CBr)CCCOCC(F)(F)F |
| InChI | InChI=1S/C15H19Br2F3O/c1-12-5-2-3-6-13(12)14(9-16,10-17)7-4-8-21-11-15(18,19)20/h2-3,5-6H,4,7-11H2,1H3 |
| InChIKey | KORDUUYQIPIYFY-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.12 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|