C10H14ClNO3S — CID 21206268
(1,1-dioxothiolan-3-yl)-(3-hydroxyphenyl)azanium chloride (PubChem CID 21206268) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is (1,1-dioxothiolan-3-yl)-(3-hydroxyphenyl)azanium chloride.
| Compound Name | (1,1-dioxothiolan-3-yl)-(3-hydroxyphenyl)azanium chloride |
|---|---|
| PubChem CID | 21206268 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (1,1-dioxothiolan-3-yl)-(3-hydroxyphenyl)azanium chloride |
| SMILES | O=S1(=O)CCC([NH2+]c2cccc(O)c2)C1.[Cl-] |
| InChI | InChI=1S/C10H13NO3S.ClH/c12-10-3-1-2-8(6-10)11-9-4-5-15(13,14)7-9;/h1-3,6,9,11-12H,4-5,7H2;1H |
| InChIKey | NYOFYGCLXKBXAC-UHFFFAOYSA-N |
| XLogP | -3.22 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | -3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|