C12H13N3O4S — CID 110456257
3-[5-[(1,1-dioxothiolan-3-yl)amino]-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 110456257) has the molecular formula C12H13N3O4S and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-[5-[(1,1-dioxothiolan-3-yl)amino]-1,3,4-oxadiazol-2-yl]phenol.
| Compound Name | 3-[5-[(1,1-dioxothiolan-3-yl)amino]-1,3,4-oxadiazol-2-yl]phenol |
|---|---|
| PubChem CID | 110456257 |
| Molecular Formula | C12H13N3O4S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 3-[5-[(1,1-dioxothiolan-3-yl)amino]-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | O=S1(=O)CCC(Nc2nnc(-c3cccc(O)c3)o2)C1 |
| InChI | InChI=1S/C12H13N3O4S/c16-10-3-1-2-8(6-10)11-14-15-12(19-11)13-9-4-5-20(17,18)7-9/h1-3,6,9,16H,4-5,7H2,(H,13,15) |
| InChIKey | ITKJSAKWSAULGK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |