C11H12N4O3S — CID 110456253
N-(1,1-dioxothiolan-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazol-2-amine (PubChem CID 110456253) has the molecular formula C11H12N4O3S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazol-2-amine.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 110456253 |
| Molecular Formula | C11H12N4O3S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-5-pyridin-2-yl-1,3,4-oxadiazol-2-amine |
| SMILES | O=S1(=O)CCC(Nc2nnc(-c3ccccn3)o2)C1 |
| InChI | InChI=1S/C11H12N4O3S/c16-19(17)6-4-8(7-19)13-11-15-14-10(18-11)9-3-1-2-5-12-9/h1-3,5,8H,4,6-7H2,(H,13,15) |
| InChIKey | BOTGFCGQKVHFSK-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 97.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |