C8H12ClN3O3S — CID 106959070
5-(2-chloroethyl)-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106959070) has the molecular formula C8H12ClN3O3S and a molecular weight of 265.72 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106959070 |
| Molecular Formula | C8H12ClN3O3S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 5-(2-chloroethyl)-N-(1,1-dioxothiolan-3-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | O=S1(=O)CCC(Nc2nnc(CCCl)o2)C1 |
| InChI | InChI=1S/C8H12ClN3O3S/c9-3-1-7-11-12-8(15-7)10-6-2-4-16(13,14)5-6/h6H,1-5H2,(H,10,12) |
| InChIKey | AUHBWLXPWYIJDP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|