C14H16ClN3O — CID 106957493
5-(2-chloroethyl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106957493) has the molecular formula C14H16ClN3O and a molecular weight of 277.76 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957493 |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.76 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 5-(2-chloroethyl)-N-(1,2,3,4-tetrahydronaphthalen-2-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | ClCCc1nnc(NC2CCc3ccccc3C2)o1 |
| InChI | InChI=1S/C14H16ClN3O/c15-8-7-13-17-18-14(19-13)16-12-6-5-10-3-1-2-4-11(10)9-12/h1-4,12H,5-9H2,(H,16,18) |
| InChIKey | GUDQSVMEWLNGPW-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.76 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|