C12H14ClN3OS — CID 106957562
5-(2-chloroethyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3,4-oxadiazol-2-amine (PubChem CID 106957562) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is 5-(2-chloroethyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3,4-oxadiazol-2-amine.
| Compound Name | 5-(2-chloroethyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3,4-oxadiazol-2-amine |
|---|---|
| PubChem CID | 106957562 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 5-(2-chloroethyl)-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)-1,3,4-oxadiazol-2-amine |
| SMILES | ClCCc1nnc(NC2CCCc3sccc32)o1 |
| InChI | InChI=1S/C12H14ClN3OS/c13-6-4-11-15-16-12(17-11)14-9-2-1-3-10-8(9)5-7-18-10/h5,7,9H,1-4,6H2,(H,14,16) |
| InChIKey | GGUYSRFJBKRPIW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|