C13H16N4O2S — CID 154770886
N-(1,1-dioxothian-3-yl)-5-pyridin-2-yl-1H-pyrazol-4-amine (PubChem CID 154770886) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is N-(1,1-dioxothian-3-yl)-5-pyridin-2-yl-1H-pyrazol-4-amine.
| Compound Name | N-(1,1-dioxothian-3-yl)-5-pyridin-2-yl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 154770886 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | N-(1,1-dioxothian-3-yl)-5-pyridin-2-yl-1H-pyrazol-4-amine |
| SMILES | O=S1(=O)CCCC(Nc2cn[nH]c2-c2ccccn2)C1 |
| InChI | InChI=1S/C13H16N4O2S/c18-20(19)7-3-4-10(9-20)16-12-8-15-17-13(12)11-5-1-2-6-14-11/h1-2,5-6,8,10,16H,3-4,7,9H2,(H,15,17) |
| InChIKey | QHNXMINKZCEHIY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |